Common Name: Lancerotriol diacetate-6-p-hydroxybenzoate
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H34O7/c1-15(2)26(30)12-11-25(6)14-22(32-18(5)28)16(3)13-21(23(25)26)33-24(29)19-7-9-20(10-8-19)31-17(4)27/h7-10,13,15,21-23,30H,11-12,14H2,1-6H3/t21-,22-,23?,25+,26+/m0/s1
InChIKey: InChIKey=NFDSTTAGNUBZJX-XJVIYFOESA-N
Formula: C26H34O7
Molecular Weight: 458.544953
Exact Mass: 458.230453
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Ahmed, A.A., Abdel-Razek, M.H., Nassar, M.I., Izumi, S., Ohta, S., Hirata, T. Phytochemistry (2001) 57, 513-5
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Daucanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 42 |
| 2 (CH2) | 41.6 |
| 3 (CH2) | 31.6 |
| 4 (C) | 86.2 |
| 5 (CH) | 54.5 |
| 6 (CH) | 71.8 |
| 7 (CH) | 127.4 |
| 8 (C) | 135.8 |
| 9 (CH) | 72.9 |
| 10 (CH2) | 46.2 |
| 11 (CH) | 36.8 |
| 12 (CH3) | 17.2 |
| 13 (CH3) | 18.2 |
| 14 (CH3) | 23.5 |
| 15 (CH3) | 18.7 |
| 1' (C) | 166.1 |
| 2' (C) | 127.6 |
| 3' (CH) | 131.2 |
| 4' (CH) | 121.6 |
| 5' (C) | 154.3 |
| 6' (CH) | 121.6 |
| 7' (CH) | 131.2 |
| 9a (C) | 170.3 |
| 9b (CH3) | 21 |
| 5'a (C) | 168.7 |
| 5'b (CH3) | 21 |