Common Name: Ozturkoside A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C39H40O20/c1-16(41)53-15-29-33(49)35(51)36(58-30(47)8-4-17-3-6-20(42)22(44)9-17)39(57-29)59-37-34(50)32(48)28(14-40)56-38(37)54-19-11-23(45)31-24(46)13-25(55-27(31)12-19)18-5-7-21(43)26(10-18)52-2/h3-13,28-29,32-40,42-45,48-51H,14-15H2,1-2H3/b8-4+/t28-,29-,32-,33-,34+,35+,36-,37-,38-,39+/m1/s1
InChIKey: InChIKey=RQZVPWREYYDWOS-DLJJOKOCSA-N
Formula: C39H40O20
Molecular Weight: 828.724429
Exact Mass: 828.211294
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Sahin, F.P., Tasdemir, D., Ruedi, P., Ezer, N., Calis, I. Phytochemistry (2004) 65, 2095-9
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 164.2 |
| 3 (CH) | 103.5 |
| 4 (C) | 182.1 |
| 5 (C) | 161.2 |
| 6 (CH) | 99.3 |
| 7 (C) | 162.7 |
| 8 (CH) | 94.8 |
| 9 (C) | 156.9 |
| 10 (C) | 105.3 |
| 1' (C) | 121.2 |
| 2' (CH) | 110.3 |
| 3' (C) | 148.1 |
| 4' (C) | 151 |
| 5' (CH) | 115.8 |
| 6' (CH) | 120.5 |
| 1'' (CH) | 97.5 |
| 2'' (CH) | 80.1 |
| 3'' (CH) | 76.1 |
| 4'' (CH) | 69.9 |
| 5'' (CH) | 76.7 |
| 6'' (CH2) | 60.4 |
| 1''' (CH) | 100.7 |
| 2''' (CH) | 73.7 |
| 3''' (CH) | 74.1 |
| 4''' (CH) | 69.8 |
| 5''' (CH) | 73.5 |
| 6''' (CH2) | 63.1 |
| 3'b (CH3) | 56 |
| 2'''b (C) | 165.9 |
| 2'''c (CH) | 114.7 |
| 2'''d (CH) | 144.6 |
| 2'''e (C) | 125.7 |
| 2'''f (CH) | 121.4 |
| 2'''g (CH) | 115.7 |
| 2'''h (C) | 145.6 |
| 2'''i (C) | 148.2 |
| 2'''j (CH) | 114.8 |
| 6'''b (C) | 170.4 |
| 6'''c (CH3) | 20.7 |