Spektraris NMR
Phorbasin B
Common Name: Phorbasin B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C20H30O4/c1-13(2)7-5-8-14(3)9-6-10-15(4)18-17(22)11-16(12-21)19(23)20(18)24/h5-6,8-11,13-14,17-18,20-22,24H,7,12H2,1-4H3/b8-5-,9-6+,15-10+/t14?,17-,18-,20+/m0/s1
InChIKey: InChIKey=MJIIVQGCRUVUTN-KRESHKLDSA-N
Formula: C20H30O4
Molecular Weight: 334.45056
Exact Mass: 334.214409
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - McNally, M., Capon, R.J. J Nat Prod (2001) 64, 645-7
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Miscellanea; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
Carbon NMR Peaks
| Position | PPM |
|---|---|
| 1 (CH) | 66.6 |
| 2 (CH) | 142.2 |
| 3 (C) | 136.8 |
| 4 (C) | 201.1 |
| 5 (CH) | 70.2 |
| 6 (CH) | 54.9 |
| 7 (C) | 133.4 |
| 8 (CH) | 129.4 |
| 9 (CH) | 125 |
| 10 (CH) | 139.1 |
| 11 (CH) | 40.3 |
| 12 (CH) | 135.7 |
| 13 (CH) | 128.3 |
| 14 (CH2) | 42.4 |
| 15 (CH) | 28.7 |
| 16 (CH3) | 22.4 |
| 17 (CH2) | 60 |
| 18 (CH3) | 16.2 |
| 19 (CH3) | 20.8 |
| 20 (CH3) | 22.4 |
