Common Name: N-trans-Feruloyl tyramine diacetate
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H23NO6/c1-15(24)28-19-8-4-17(5-9-19)12-13-23-22(26)11-7-18-6-10-20(29-16(2)25)21(14-18)27-3/h4-11,14H,12-13H2,1-3H3,(H,23,26)/b11-7+
InChIKey: InChIKey=TWZYHKRHASAOIY-YRNVUSSQSA-N
Formula: C22H23N1O6
Molecular Weight: 397.422
Exact Mass: 397.152537
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Maurya, R., Handa, S.S. Phytochemistry (1998) 49, 1343-5
Species:
Notes: Family : Aromatics, Type : Phenyl-alkanoids, Group : Phenylpropanoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 149.3 |
| 2 (CH) | 121.7 |
| 3 (C) | 133.8 |
| 4 (C) | 140.9 |
| 5 (CH) | 120.6 |
| 6 (CH) | 123.1 |
| 7 (CH) | 140.3 |
| 8 (CH) | 111.2 |
| 9 (C) | 165.7 |
| 1' (CH2) | 40.7 |
| 2' (CH2) | 34.9 |
| 3' (C) | 136.5 |
| 4' (CH) | 129.7 |
| 5' (CH) | 120.8 |
| 6' (C) | 151.3 |
| 7' (CH) | 120.8 |
| 8' (CH) | 129.7 |
| 3a (CH3) | 55.9 |
| 4a (C) | 168.8 |
| 4b (CH3) | 20.6 |
| 6'a (C) | 169.7 |
| 6'b (CH3) | 21.1 |