Common Name: 20245-39-0
Synonyms: 20245-39-0
CAS Registry Number:
InChI: InChI=1S/C18H16O5/c1-9(2)3-5-11-13(20)8-15-16(17(11)21)18(22)12-7-10(19)4-6-14(12)23-15/h3-4,6-8,19-21H,5H2,1-2H3
InChIKey: InChIKey=FLWKTILHZPCXDW-UHFFFAOYSA-N
Formula: C18H16O5
Molecular Weight: 312.317323
Exact Mass: 312.099774
NMR Solvent: CDDl3 + DMSO-d6
MHz:
Calibration:
NMR references: 13C - Cortez, D.A.G., Young, M.C.M., Marston, A., Wolfender, J.L., Hostettmann, K. Phytochemistry (1998) 47, 1367-74
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 160.18 |
| 2 (C) | 110.23 |
| 3 (C) | 163.23 |
| 4 (CH) | 93.36 |
| 4a (C) | 155.74 |
| 5 (CH) | 118.35 |
| 6 (CH) | 122.46 |
| 7 (C) | 153.51 |
| 8 (CH) | 108.89 |
| 8a (C) | 120.96 |
| 9 (C) | 180.37 |
| 9a (C) | 102.64 |
| 10a (C) | 149.61 |
| 2a (CH2) | 21.29 |
| 2b (CH) | 123.9 |
| 2c (C) | 131.4 |
| 2d (CH3) | 17.84 |
| 2ca (CH3) | 25.78 |