Common Name: (Z)-2-Methyl-2-butenoic acid (1beta)-2alpha-[1,5-dimethyl-3-acetoxy-4-hexenyl]-4beta-acetoxy-5beta-methylcyclohexyl ester
Synonyms: (Z)-2-Methyl-2-butenoic acid (1beta)-2alpha-[1,5-dimethyl-3-acetoxy-4-hexenyl]-4beta-acetoxy-5beta-methylcyclohexyl ester
CAS Registry Number:
InChI: InChI=1S/C24H38O6/c1-9-15(4)24(27)30-23-12-17(6)22(29-19(8)26)13-21(23)16(5)11-20(10-14(2)3)28-18(7)25/h9-10,16-17,20-23H,11-13H2,1-8H3/b15-9-/t16?,17-,20?,21-,22+,23+/m0/s1
InChIKey: InChIKey=ZIISMZIZMXGTAW-AOMFGKCQSA-N
Formula: C24H38O6
Molecular Weight: 422.55584
Exact Mass: 422.266839
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Cheng, M.J., Jayaprakasam, B., Ishikawa, T., Seki, H., Tsai, I.L., Wang, J.J., Chen, I.S. Helv Chim Acta (2002) 85, 1909-14
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Bisabolanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 72.5 |
| 2 (CH2) | 35 |
| 3 (CH) | 33.9 |
| 4 (CH) | 72 |
| 5 (CH2) | 28.1 |
| 6 (CH) | 38.9 |
| 7 (CH) | 26.8 |
| 8 (CH2) | 40 |
| 9 (CH) | 69.4 |
| 10 (CH) | 124 |
| 11 (C) | 137.4 |
| 12 (CH3) | 18.5 |
| 13 (CH3) | 25.9 |
| 14 (CH3) | 13.8 |
| 15 (CH3) | 17.6 |
| 1a (C) | 167.6 |
| 1b (C) | 128.2 |
| 1c (CH) | 137.6 |
| 1d (CH3) | 15.8 |
| 1e (CH3) | 20.6 |
| 4a (C) | 170.9 |
| 4b (CH3) | 21.3 |
| 9a (C) | 170.3 |
| 9b (CH3) | 21.4 |