Common Name: Briarellin L
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H38O7/c1-7-8-20(28)32-25(5)11-9-17-15(3)24(29)33-26(6)12-10-18(30-16(4)27)14(2)13-19-22(25)21(17)23(26)31-19/h15,17-19,21-23H,2,7-13H2,1,3-6H3/t15-,17+,18-,19+,21+,22+,23+,25-,26+/m1/s1
InChIKey: InChIKey=VFRMMXJTKVAFEN-QIEIXIRHSA-N
Formula: C26H38O7
Molecular Weight: 462.576716
Exact Mass: 462.261754
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Ospina, C.A., Rodriguez, A.D., Ortega-Barria, E., Capson, T.L. J Nat Prod (2003) 66, 357-63
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Eunicellanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 44.9 |
| 2 (CH) | 90.6 |
| 3 (C) | 84.8 |
| 4 (CH2) | 28.3 |
| 5 (CH2) | 30.1 |
| 6 (CH) | 74.9 |
| 7 (C) | 144.5 |
| 8 (CH2) | 41.5 |
| 9 (CH) | 82.2 |
| 10 (CH) | 48 |
| 11 (C) | 80.9 |
| 12 (CH2) | 30.3 |
| 13 (CH2) | 16.8 |
| 14 (CH) | 36.9 |
| 15 (CH3) | 20.5 |
| 16 (CH2) | 118.6 |
| 17 (CH3) | 28.9 |
| 18 (CH) | 45.8 |
| 19 (CH3) | 17.4 |
| 20 (C) | 176.2 |
| 6a (C) | 170.7 |
| 6b (CH3) | 21.3 |
| 11a (C) | 172.4 |
| 11b (CH2) | 37.4 |
| 11c (CH2) | 18.4 |
| 11d (CH3) | 13.6 |