Common Name: Liriopeoside A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C21H36O7/c1-10(2)12-7-8-21(4)14(23)6-5-11(3)15(21)19(12)28-20-18(26)17(25)16(24)13(9-22)27-20/h5,10,12-20,22-26H,6-9H2,1-4H3/t12-,13+,14+,15-,16+,17-,18+,19+,20-,21-/m0/s1
InChIKey: InChIKey=XVRMQCBYHLAHLK-GSAQYRDCSA-N
Formula: C21H36O7
Molecular Weight: 400.507155
Exact Mass: 400.246104
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Cheng, Z.H., Wu, T., Bligh, S.W., Bashall, A., Yu, B.Y. J Nat Prod (2004) 67, 1761-3
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Eudesmanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 74.3 |
| 2 (CH2) | 31.8 |
| 3 (CH) | 120.4 |
| 4 (C) | 133.5 |
| 5 (CH) | 46.2 |
| 6 (CH) | 78.1 |
| 7 (CH) | 45.2 |
| 8 (CH2) | 20.3 |
| 9 (CH2) | 32.1 |
| 10 (C) | 36.3 |
| 11 (CH) | 27.6 |
| 12 (CH3) | 20.7 |
| 13 (CH3) | 21.4 |
| 14 (CH3) | 24.8 |
| 15 (CH3) | 22.1 |
| 1' (CH) | 106.2 |
| 2' (CH) | 75.5 |
| 3' (CH) | 77.6 |
| 4' (CH) | 71.9 |
| 5' (CH) | 78.3 |
| 6' (CH2) | 62.9 |