Common Name: 1b-D-Glucopyranosyloxy-6a-hydroxyeudesman-4(15)-ene
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C21H36O7/c1-10(2)12-7-8-21(4)14(6-5-11(3)15(21)16(12)23)28-20-19(26)18(25)17(24)13(9-22)27-20/h10,12-20,22-26H,3,5-9H2,1-2,4H3/t12-,13+,14+,15+,16-,17+,18-,19+,20-,21-/m0/s1
InChIKey: InChIKey=INQCOEAMYYNELI-WJQLCHQESA-N
Formula: C21H36O7
Molecular Weight: 400.507155
Exact Mass: 400.246104
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Li, X., Yang, M., Han, Y.F., Gao, K. Planta Med (2005) 71, 268-72
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Eudesmanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 84.2 |
| 2 (CH2) | 29.5 |
| 3 (CH2) | 35.3 |
| 4 (C) | 146.4 |
| 5 (CH) | 56.2 |
| 6 (CH) | 66.7 |
| 7 (CH) | 50.5 |
| 8 (CH2) | 18.4 |
| 9 (CH2) | 36.5 |
| 10 (C) | 41.4 |
| 11 (CH) | 26 |
| 12 (CH3) | 16 |
| 13 (CH3) | 21.2 |
| 14 (CH3) | 12.4 |
| 15 (CH2) | 108.2 |
| 1' (CH) | 100.9 |
| 2' (CH) | 74.2 |
| 3' (CH) | 77.3 |
| 4' (CH) | 71.1 |
| 5' (CH) | 76.8 |
| 6' (CH2) | 62.5 |